C15H17NO5S — CID 127038553
4-(3,4,5-trimethoxyphenyl)benzenesulfonamide (PubChem CID 127038553) has the molecular formula C15H17NO5S and a molecular weight of 323.37 g/mol. Its IUPAC name is 4-(3,4,5-trimethoxyphenyl)benzenesulfonamide.
| Compound Name | 4-(3,4,5-trimethoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 127038553 |
| Molecular Formula | C15H17NO5S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 4-(3,4,5-trimethoxyphenyl)benzenesulfonamide |
| SMILES | COc1cc(-c2ccc(S(N)(=O)=O)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C15H17NO5S/c1-19-13-8-11(9-14(20-2)15(13)21-3)10-4-6-12(7-5-10)22(16,17)18/h4-9H,1-3H3,(H2,16,17,18) |
| InChIKey | GUHMJKPMFNHUCM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |