C21H22Cl2N2O4 — CID 46194884
2-amino-2-[[5-[(4,6-dichloro-1-benzofuran-2-yl)methoxy]-2,3-dihydroindol-1-yl]methyl]propane-1,3-diol (PubChem CID 46194884) has the molecular formula C21H22Cl2N2O4 and a molecular weight of 437.32 g/mol. Its IUPAC name is 2-amino-2-[[5-[(4,6-dichloro-1-benzofuran-2-yl)methoxy]-2,3-dihydroindol-1-yl]methyl]propane-1,3-diol.
| Compound Name | 2-amino-2-[[5-[(4,6-dichloro-1-benzofuran-2-yl)methoxy]-2,3-dihydroindol-1-yl]methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 46194884 |
| Molecular Formula | C21H22Cl2N2O4 |
| Molecular Weight | 437.32 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 2-amino-2-[[5-[(4,6-dichloro-1-benzofuran-2-yl)methoxy]-2,3-dihydroindol-1-yl]methyl]propane-1,3-diol |
| SMILES | NC(CO)(CO)CN1CCc2cc(OCc3cc4c(Cl)cc(Cl)cc4o3)ccc21 |
| InChI | InChI=1S/C21H22Cl2N2O4/c22-14-6-18(23)17-8-16(29-20(17)7-14)9-28-15-1-2-19-13(5-15)3-4-25(19)10-21(24,11-26)12-27/h1-2,5-8,26-27H,3-4,9-12,24H2 |
| InChIKey | FBQHSFTYWKCWBQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|