C16H18F3N3O2S — CID 46196553
2-cyclopentyl-N-[(Z)-[3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-ylidene]amino]acetamide (PubChem CID 46196553) has the molecular formula C16H18F3N3O2S and a molecular weight of 373.40 g/mol. Its IUPAC name is 2-cyclopentyl-N-[(Z)-[3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-ylidene]amino]acetamide.
| Compound Name | 2-cyclopentyl-N-[(Z)-[3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-ylidene]amino]acetamide |
|---|---|
| PubChem CID | 46196553 |
| Molecular Formula | C16H18F3N3O2S |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2-cyclopentyl-N-[(Z)-[3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-ylidene]amino]acetamide |
| SMILES | Cn1/c(=N/NC(=O)CC2CCCC2)sc2cc(OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C16H18F3N3O2S/c1-22-12-7-6-11(24-16(17,18)19)9-13(12)25-15(22)21-20-14(23)8-10-4-2-3-5-10/h6-7,9-10H,2-5,8H2,1H3,(H,20,23)/b21-15- |
| InChIKey | ZBHICRAJUNKGFK-QNGOZBTKSA-N |
| XLogP | 3.65 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|