C15H18F3N3O2S — CID 46230355
4-methyl-N-[(Z)-[3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-ylidene]amino]pentanamide (PubChem CID 46230355) has the molecular formula C15H18F3N3O2S and a molecular weight of 361.39 g/mol. Its IUPAC name is 4-methyl-N-[(Z)-[3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-ylidene]amino]pentanamide.
| Compound Name | 4-methyl-N-[(Z)-[3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-ylidene]amino]pentanamide |
|---|---|
| PubChem CID | 46230355 |
| Molecular Formula | C15H18F3N3O2S |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 4-methyl-N-[(Z)-[3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-ylidene]amino]pentanamide |
| SMILES | CC(C)CCC(=O)N/N=c1\sc2cc(OC(F)(F)F)ccc2n1C |
| InChI | InChI=1S/C15H18F3N3O2S/c1-9(2)4-7-13(22)19-20-14-21(3)11-6-5-10(8-12(11)24-14)23-15(16,17)18/h5-6,8-9H,4,7H2,1-3H3,(H,19,22)/b20-14- |
| InChIKey | UTBTUCQPGOAGLY-ZHZULCJRSA-N |
| XLogP | 3.51 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|