C13H14F3N3O3S — CID 46196554
propan-2-yl N-[(Z)-[3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-ylidene]amino]carbamate (PubChem CID 46196554) has the molecular formula C13H14F3N3O3S and a molecular weight of 349.33 g/mol. Its IUPAC name is propan-2-yl N-[(Z)-[3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-ylidene]amino]carbamate.
| Compound Name | propan-2-yl N-[(Z)-[3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-ylidene]amino]carbamate |
|---|---|
| PubChem CID | 46196554 |
| Molecular Formula | C13H14F3N3O3S |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | propan-2-yl N-[(Z)-[3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-ylidene]amino]carbamate |
| SMILES | CC(C)OC(=O)N/N=c1\sc2cc(OC(F)(F)F)ccc2n1C |
| InChI | InChI=1S/C13H14F3N3O3S/c1-7(2)21-12(20)18-17-11-19(3)9-5-4-8(6-10(9)23-11)22-13(14,15)16/h4-7H,1-3H3,(H,18,20)/b17-11- |
| InChIKey | ONWOFJCPRAZRKC-BOPFTXTBSA-N |
| XLogP | 3.09 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|