C32H53N6O6P — CID 46196711
(2S)-2-[[(2S)-2-azido-3-phenylpropanoyl]amino]-N-[(2S)-1-[[(E,3S)-1-diethoxyphosphoryl-5-methylhex-1-en-3-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-methylpentanamide (PubChem CID 46196711) has the molecular formula C32H53N6O6P and a molecular weight of 648.79 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-azido-3-phenylpropanoyl]amino]-N-[(2S)-1-[[(E,3S)-1-diethoxyphosphoryl-5-methylhex-1-en-3-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-methylpentanamide.
| Compound Name | (2S)-2-[[(2S)-2-azido-3-phenylpropanoyl]amino]-N-[(2S)-1-[[(E,3S)-1-diethoxyphosphoryl-5-methylhex-1-en-3-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 46196711 |
| Molecular Formula | C32H53N6O6P |
| Molecular Weight | 648.79 g/mol |
| Exact Mass | 648.38 |
| IUPAC Name | (2S)-2-[[(2S)-2-azido-3-phenylpropanoyl]amino]-N-[(2S)-1-[[(E,3S)-1-diethoxyphosphoryl-5-methylhex-1-en-3-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-methylpentanamide |
| SMILES | CCOP(=O)(/C=C/[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccccc1)N=[N+]=[N-])OCC |
| InChI | InChI=1S/C32H53N6O6P/c1-9-43-45(42,44-10-2)17-16-26(18-22(3)4)34-30(39)27(19-23(5)6)35-31(40)28(20-24(7)8)36-32(41)29(37-38-33)21-25-14-12-11-13-15-25/h11-17,22-24,26-29H,9-10,18-21H2,1-8H3,(H,34,39)(H,35,40)(H,36,41)/b17-16+/t26-,27+,28+,29+/m1/s1 |
| InChIKey | MAYLHNATMCXZSQ-KQROQYMGSA-N |
| XLogP | 6.28 |
| TPSA | 171.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.79 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|