C28H36O6 — CID 46196843
1-[(4S,5S)-2,2-dimethyl-5-[(S)-phenyl(phenylmethoxy)methyl]-1,3-dioxolan-4-yl]-4-(oxan-2-yloxy)butan-1-one (PubChem CID 46196843) has the molecular formula C28H36O6 and a molecular weight of 468.59 g/mol. Its IUPAC name is 1-[(4S,5S)-2,2-dimethyl-5-[(S)-phenyl(phenylmethoxy)methyl]-1,3-dioxolan-4-yl]-4-(oxan-2-yloxy)butan-1-one.
| Compound Name | 1-[(4S,5S)-2,2-dimethyl-5-[(S)-phenyl(phenylmethoxy)methyl]-1,3-dioxolan-4-yl]-4-(oxan-2-yloxy)butan-1-one |
|---|---|
| PubChem CID | 46196843 |
| Molecular Formula | C28H36O6 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 1-[(4S,5S)-2,2-dimethyl-5-[(S)-phenyl(phenylmethoxy)methyl]-1,3-dioxolan-4-yl]-4-(oxan-2-yloxy)butan-1-one |
| SMILES | CC1(C)O[C@@H]([C@@H](OCc2ccccc2)c2ccccc2)[C@@H](C(=O)CCCOC2CCCCO2)O1 |
| InChI | InChI=1S/C28H36O6/c1-28(2)33-26(23(29)16-11-19-31-24-17-9-10-18-30-24)27(34-28)25(22-14-7-4-8-15-22)32-20-21-12-5-3-6-13-21/h3-8,12-15,24-27H,9-11,16-20H2,1-2H3/t24?,25-,26+,27-/m0/s1 |
| InChIKey | PGQKJCVESWEURW-ZAEYVGPMSA-N |
| XLogP | 5.36 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|