C15H26O4Si — CID 46201118
(4S)-5-[(2R,3S)-3-ethenyl-5-oxooxolan-2-yl]-4-methyl-4-trimethylsilyloxypentanal (PubChem CID 46201118) has the molecular formula C15H26O4Si and a molecular weight of 298.46 g/mol. Its IUPAC name is (4S)-5-[(2R,3S)-3-ethenyl-5-oxooxolan-2-yl]-4-methyl-4-trimethylsilyloxypentanal.
| Compound Name | (4S)-5-[(2R,3S)-3-ethenyl-5-oxooxolan-2-yl]-4-methyl-4-trimethylsilyloxypentanal |
|---|---|
| PubChem CID | 46201118 |
| Molecular Formula | C15H26O4Si |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (4S)-5-[(2R,3S)-3-ethenyl-5-oxooxolan-2-yl]-4-methyl-4-trimethylsilyloxypentanal |
| SMILES | C=C[C@@H]1CC(=O)O[C@@H]1C[C@](C)(CCC=O)O[Si](C)(C)C |
| InChI | InChI=1S/C15H26O4Si/c1-6-12-10-14(17)18-13(12)11-15(2,8-7-9-16)19-20(3,4)5/h6,9,12-13H,1,7-8,10-11H2,2-5H3/t12-,13-,15+/m1/s1 |
| InChIKey | PRRCUCCOHOQAID-NFAWXSAZSA-N |
| XLogP | 3.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|