C21H38O4Si — CID 24754868
(4S,5R)-5-[(2S)-5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-2-methyloct-7-enyl]-4-ethenyloxolan-2-one (PubChem CID 24754868) has the molecular formula C21H38O4Si and a molecular weight of 382.62 g/mol. Its IUPAC name is (4S,5R)-5-[(2S)-5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-2-methyloct-7-enyl]-4-ethenyloxolan-2-one.
| Compound Name | (4S,5R)-5-[(2S)-5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-2-methyloct-7-enyl]-4-ethenyloxolan-2-one |
|---|---|
| PubChem CID | 24754868 |
| Molecular Formula | C21H38O4Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | (4S,5R)-5-[(2S)-5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-2-methyloct-7-enyl]-4-ethenyloxolan-2-one |
| SMILES | C=CCC(CC[C@](C)(O)C[C@H]1OC(=O)C[C@H]1C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38O4Si/c1-9-11-17(25-26(7,8)20(3,4)5)12-13-21(6,23)15-18-16(10-2)14-19(22)24-18/h9-10,16-18,23H,1-2,11-15H2,3-8H3/t16-,17?,18-,21+/m1/s1 |
| InChIKey | LPYPAACVWRQBKW-SEFOKTEQSA-N |
| XLogP | 4.99 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|