C18H23NO5 — CID 46201269
(3aR,4S,4aR,7aR,8aS)-4-(1,3-benzodioxol-5-yl)-5-hydroxy-2,2-dimethyl-3a,4,4a,6,7,7a,8,8a-octahydro-[1,3]dioxolo[4,5-f]indole (PubChem CID 46201269) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is (3aR,4S,4aR,7aR,8aS)-4-(1,3-benzodioxol-5-yl)-5-hydroxy-2,2-dimethyl-3a,4,4a,6,7,7a,8,8a-octahydro-[1,3]dioxolo[4,5-f]indole.
| Compound Name | (3aR,4S,4aR,7aR,8aS)-4-(1,3-benzodioxol-5-yl)-5-hydroxy-2,2-dimethyl-3a,4,4a,6,7,7a,8,8a-octahydro-[1,3]dioxolo[4,5-f]indole |
|---|---|
| PubChem CID | 46201269 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (3aR,4S,4aR,7aR,8aS)-4-(1,3-benzodioxol-5-yl)-5-hydroxy-2,2-dimethyl-3a,4,4a,6,7,7a,8,8a-octahydro-[1,3]dioxolo[4,5-f]indole |
| SMILES | CC1(C)O[C@@H]2[C@@H](c3ccc4c(c3)OCO4)[C@H]3[C@H](CCN3O)C[C@@H]2O1 |
| InChI | InChI=1S/C18H23NO5/c1-18(2)23-14-8-11-5-6-19(20)16(11)15(17(14)24-18)10-3-4-12-13(7-10)22-9-21-12/h3-4,7,11,14-17,20H,5-6,8-9H2,1-2H3/t11-,14+,15+,16-,17+/m1/s1 |
| InChIKey | UEJFRVRPGABBBA-UTVHMOSLSA-N |
| XLogP | 2.50 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |