C19H28N2O4 — CID 46201368
(E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-[2-(4-methoxyphenyl)-1,3-dioxan-2-yl]ethanimine (PubChem CID 46201368) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-[2-(4-methoxyphenyl)-1,3-dioxan-2-yl]ethanimine.
| Compound Name | (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-[2-(4-methoxyphenyl)-1,3-dioxan-2-yl]ethanimine |
|---|---|
| PubChem CID | 46201368 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-[2-(4-methoxyphenyl)-1,3-dioxan-2-yl]ethanimine |
| SMILES | COC[C@@H]1CCCN1/N=C/CC1(c2ccc(OC)cc2)OCCCO1 |
| InChI | InChI=1S/C19H28N2O4/c1-22-15-17-5-3-12-21(17)20-11-10-19(24-13-4-14-25-19)16-6-8-18(23-2)9-7-16/h6-9,11,17H,3-5,10,12-15H2,1-2H3/b20-11+/t17-/m0/s1 |
| InChIKey | GHGVJHSEQFZEMZ-PBGVMVHZSA-N |
| XLogP | 2.77 |
| TPSA | 52.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|