C18H25NO4 — CID 46845713
(1S,8S,8aR)-8-(methoxymethoxy)-1-[(4-methoxyphenyl)methoxy]-1,2,3,5,8,8a-hexahydroindolizine (PubChem CID 46845713) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is (1S,8S,8aR)-8-(methoxymethoxy)-1-[(4-methoxyphenyl)methoxy]-1,2,3,5,8,8a-hexahydroindolizine.
| Compound Name | (1S,8S,8aR)-8-(methoxymethoxy)-1-[(4-methoxyphenyl)methoxy]-1,2,3,5,8,8a-hexahydroindolizine |
|---|---|
| PubChem CID | 46845713 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | (1S,8S,8aR)-8-(methoxymethoxy)-1-[(4-methoxyphenyl)methoxy]-1,2,3,5,8,8a-hexahydroindolizine |
| SMILES | COCO[C@H]1C=CCN2CC[C@H](OCc3ccc(OC)cc3)[C@H]12 |
| InChI | InChI=1S/C18H25NO4/c1-20-13-23-16-4-3-10-19-11-9-17(18(16)19)22-12-14-5-7-15(21-2)8-6-14/h3-8,16-18H,9-13H2,1-2H3/t16-,17-,18-/m0/s1 |
| InChIKey | ZLQFKDOUOGGXLH-BZSNNMDCSA-N |
| XLogP | 2.21 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|