C11H16N2O5 — CID 46201478
(2S)-5-amino-2-(4,6-dioxo-1,3,3a,6a-tetrahydrofuro[3,4-c]pyrrol-5-yl)pentanoic acid (PubChem CID 46201478) has the molecular formula C11H16N2O5 and a molecular weight of 256.26 g/mol. Its IUPAC name is (2S)-5-amino-2-(4,6-dioxo-1,3,3a,6a-tetrahydrofuro[3,4-c]pyrrol-5-yl)pentanoic acid.
| Compound Name | (2S)-5-amino-2-(4,6-dioxo-1,3,3a,6a-tetrahydrofuro[3,4-c]pyrrol-5-yl)pentanoic acid |
|---|---|
| PubChem CID | 46201478 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (2S)-5-amino-2-(4,6-dioxo-1,3,3a,6a-tetrahydrofuro[3,4-c]pyrrol-5-yl)pentanoic acid |
| SMILES | NCCC[C@@H](C(=O)O)N1C(=O)C2COCC2C1=O |
| InChI | InChI=1S/C11H16N2O5/c12-3-1-2-8(11(16)17)13-9(14)6-4-18-5-7(6)10(13)15/h6-8H,1-5,12H2,(H,16,17)/t6?,7?,8-/m0/s1 |
| InChIKey | UUSUJXKHZSZJFH-RRQHEKLDSA-N |
| XLogP | -1.19 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|