C12H16N2O6 — CID 122609227
1-(5-amino-1-carboxypentyl)-2,6-dioxo-3H-pyridine-4-carboxylic acid (PubChem CID 122609227) has the molecular formula C12H16N2O6 and a molecular weight of 284.27 g/mol. Its IUPAC name is 1-(5-amino-1-carboxypentyl)-2,6-dioxo-3H-pyridine-4-carboxylic acid.
| Compound Name | 1-(5-amino-1-carboxypentyl)-2,6-dioxo-3H-pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 122609227 |
| Molecular Formula | C12H16N2O6 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 1-(5-amino-1-carboxypentyl)-2,6-dioxo-3H-pyridine-4-carboxylic acid |
| SMILES | NCCCCC(C(=O)O)N1C(=O)C=C(C(=O)O)CC1=O |
| InChI | InChI=1S/C12H16N2O6/c13-4-2-1-3-8(12(19)20)14-9(15)5-7(11(17)18)6-10(14)16/h5,8H,1-4,6,13H2,(H,17,18)(H,19,20) |
| InChIKey | FPKYKHXLBYYALY-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|