C11H17N3O4 — CID 46201627
(2S)-5-amino-2-(4,6-dioxo-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)pentanoic acid (PubChem CID 46201627) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is (2S)-5-amino-2-(4,6-dioxo-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)pentanoic acid.
| Compound Name | (2S)-5-amino-2-(4,6-dioxo-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)pentanoic acid |
|---|---|
| PubChem CID | 46201627 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | (2S)-5-amino-2-(4,6-dioxo-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)pentanoic acid |
| SMILES | NCCC[C@@H](C(=O)O)N1C(=O)C2CNCC2C1=O |
| InChI | InChI=1S/C11H17N3O4/c12-3-1-2-8(11(17)18)14-9(15)6-4-13-5-7(6)10(14)16/h6-8,13H,1-5,12H2,(H,17,18)/t6?,7?,8-/m0/s1 |
| InChIKey | SJBSJMWHDPEIHP-RRQHEKLDSA-N |
| XLogP | -1.62 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|