C23H17F3N2O3S — CID 46202459
2-[3-(3-ethylsulfonylphenoxy)phenyl]-8-(trifluoromethyl)quinoxaline (PubChem CID 46202459) has the molecular formula C23H17F3N2O3S and a molecular weight of 458.46 g/mol. Its IUPAC name is 2-[3-(3-ethylsulfonylphenoxy)phenyl]-8-(trifluoromethyl)quinoxaline.
| Compound Name | 2-[3-(3-ethylsulfonylphenoxy)phenyl]-8-(trifluoromethyl)quinoxaline |
|---|---|
| PubChem CID | 46202459 |
| Molecular Formula | C23H17F3N2O3S |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 2-[3-(3-ethylsulfonylphenoxy)phenyl]-8-(trifluoromethyl)quinoxaline |
| SMILES | CCS(=O)(=O)c1cccc(Oc2cccc(-c3cnc4cccc(C(F)(F)F)c4n3)c2)c1 |
| InChI | InChI=1S/C23H17F3N2O3S/c1-2-32(29,30)18-9-4-8-17(13-18)31-16-7-3-6-15(12-16)21-14-27-20-11-5-10-19(22(20)28-21)23(24,25)26/h3-14H,2H2,1H3 |
| InChIKey | OFQSZGSAHQLUNY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |