C17H10F6N2O3S — CID 46203862
[3-[3-methyl-5-(trifluoromethyl)quinoxalin-2-yl]phenyl] trifluoromethanesulfonate (PubChem CID 46203862) has the molecular formula C17H10F6N2O3S and a molecular weight of 436.33 g/mol. Its IUPAC name is [3-[3-methyl-5-(trifluoromethyl)quinoxalin-2-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-[3-methyl-5-(trifluoromethyl)quinoxalin-2-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 46203862 |
| Molecular Formula | C17H10F6N2O3S |
| Molecular Weight | 436.33 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | [3-[3-methyl-5-(trifluoromethyl)quinoxalin-2-yl]phenyl] trifluoromethanesulfonate |
| SMILES | Cc1nc2c(C(F)(F)F)cccc2nc1-c1cccc(OS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C17H10F6N2O3S/c1-9-14(25-13-7-3-6-12(15(13)24-9)16(18,19)20)10-4-2-5-11(8-10)28-29(26,27)17(21,22)23/h2-8H,1H3 |
| InChIKey | YIKMPRUHBCTLNO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.33 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|