C16H10F6N2O3S — CID 86650923
[3-[2-methyl-4-(trifluoromethyl)benzimidazol-1-yl]phenyl] trifluoromethanesulfonate (PubChem CID 86650923) has the molecular formula C16H10F6N2O3S and a molecular weight of 424.32 g/mol. Its IUPAC name is [3-[2-methyl-4-(trifluoromethyl)benzimidazol-1-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-[2-methyl-4-(trifluoromethyl)benzimidazol-1-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86650923 |
| Molecular Formula | C16H10F6N2O3S |
| Molecular Weight | 424.32 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | [3-[2-methyl-4-(trifluoromethyl)benzimidazol-1-yl]phenyl] trifluoromethanesulfonate |
| SMILES | Cc1nc2c(C(F)(F)F)cccc2n1-c1cccc(OS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H10F6N2O3S/c1-9-23-14-12(15(17,18)19)6-3-7-13(14)24(9)10-4-2-5-11(8-10)27-28(25,26)16(20,21)22/h2-8H,1H3 |
| InChIKey | WHGAIAYGYRWDKN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.32 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|