C21H19FO4S — CID 46205853
2-[6-fluoro-3-methyl-4-[(4-methylsulfonylphenyl)methyl]naphthalen-2-yl]acetic acid (PubChem CID 46205853) has the molecular formula C21H19FO4S and a molecular weight of 386.44 g/mol. Its IUPAC name is 2-[6-fluoro-3-methyl-4-[(4-methylsulfonylphenyl)methyl]naphthalen-2-yl]acetic acid.
| Compound Name | 2-[6-fluoro-3-methyl-4-[(4-methylsulfonylphenyl)methyl]naphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 46205853 |
| Molecular Formula | C21H19FO4S |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 2-[6-fluoro-3-methyl-4-[(4-methylsulfonylphenyl)methyl]naphthalen-2-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)cc2ccc(F)cc2c1Cc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H19FO4S/c1-13-16(11-21(23)24)10-15-5-6-17(22)12-20(15)19(13)9-14-3-7-18(8-4-14)27(2,25)26/h3-8,10,12H,9,11H2,1-2H3,(H,23,24) |
| InChIKey | YAAOPJLHLAZECX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |