C25H28N6O3 — CID 46205879
3-[11-[(4-methylpiperazin-1-yl)methyl]-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]phenol (PubChem CID 46205879) has the molecular formula C25H28N6O3 and a molecular weight of 460.54 g/mol. Its IUPAC name is 3-[11-[(4-methylpiperazin-1-yl)methyl]-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]phenol.
| Compound Name | 3-[11-[(4-methylpiperazin-1-yl)methyl]-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]phenol |
|---|---|
| PubChem CID | 46205879 |
| Molecular Formula | C25H28N6O3 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 3-[11-[(4-methylpiperazin-1-yl)methyl]-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]phenol |
| SMILES | CN1CCN(Cc2ccc3c(n2)oc2c(N4CCOCC4)nc(-c4cccc(O)c4)nc23)CC1 |
| InChI | InChI=1S/C25H28N6O3/c1-29-7-9-30(10-8-29)16-18-5-6-20-21-22(34-25(20)26-18)24(31-11-13-33-14-12-31)28-23(27-21)17-3-2-4-19(32)15-17/h2-6,15,32H,7-14,16H2,1H3 |
| InChIKey | GKMRBVIRUIAIPA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |