C15H17NO2 — CID 46211093
(5S)-5-[(2R)-but-3-en-2-yl]-5-methyl-4-methylidene-3-phenyl-1,3-oxazolidin-2-one (PubChem CID 46211093) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is (5S)-5-[(2R)-but-3-en-2-yl]-5-methyl-4-methylidene-3-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-[(2R)-but-3-en-2-yl]-5-methyl-4-methylidene-3-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 46211093 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | (5S)-5-[(2R)-but-3-en-2-yl]-5-methyl-4-methylidene-3-phenyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H](C)[C@]1(C)OC(=O)N(c2ccccc2)C1=C |
| InChI | InChI=1S/C15H17NO2/c1-5-11(2)15(4)12(3)16(14(17)18-15)13-9-7-6-8-10-13/h5-11H,1,3H2,2,4H3/t11-,15+/m1/s1 |
| InChIKey | NLIXSNHANVRXQJ-ABAIWWIYSA-N |
| XLogP | 3.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|