C38H42N4O10 — CID 46211305
N-[(2R)-1-[2-[2-[2-[[(2R)-2-[(2,3-dihydroxybenzoyl)amino]-3-phenylpropanoyl]amino]ethoxy]ethoxy]ethylamino]-1-oxo-3-phenylpropan-2-yl]-2,3-dihydroxybenzamide (PubChem CID 46211305) has the molecular formula C38H42N4O10 and a molecular weight of 714.77 g/mol. Its IUPAC name is N-[(2R)-1-[2-[2-[2-[[(2R)-2-[(2,3-dihydroxybenzoyl)amino]-3-phenylpropanoyl]amino]ethoxy]ethoxy]ethylamino]-1-oxo-3-phenylpropan-2-yl]-2,3-dihydroxybenzamide.
| Compound Name | N-[(2R)-1-[2-[2-[2-[[(2R)-2-[(2,3-dihydroxybenzoyl)amino]-3-phenylpropanoyl]amino]ethoxy]ethoxy]ethylamino]-1-oxo-3-phenylpropan-2-yl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 46211305 |
| Molecular Formula | C38H42N4O10 |
| Molecular Weight | 714.77 g/mol |
| Exact Mass | 714.29 |
| IUPAC Name | N-[(2R)-1-[2-[2-[2-[[(2R)-2-[(2,3-dihydroxybenzoyl)amino]-3-phenylpropanoyl]amino]ethoxy]ethoxy]ethylamino]-1-oxo-3-phenylpropan-2-yl]-2,3-dihydroxybenzamide |
| SMILES | O=C(N[C@H](Cc1ccccc1)C(=O)NCCOCCOCCNC(=O)[C@@H](Cc1ccccc1)NC(=O)c1cccc(O)c1O)c1cccc(O)c1O |
| InChI | InChI=1S/C38H42N4O10/c43-31-15-7-13-27(33(31)45)35(47)41-29(23-25-9-3-1-4-10-25)37(49)39-17-19-51-21-22-52-20-18-40-38(50)30(24-26-11-5-2-6-12-26)42-36(48)28-14-8-16-32(44)34(28)46/h1-16,29-30,43-46H,17-24H2,(H,39,49)(H,40,50)(H,41,47)(H,42,48)/t29-,30-/m1/s1 |
| InChIKey | WUFUAAICIFCDPI-LOYHVIPDSA-N |
| XLogP | 2.16 |
| TPSA | 215.78 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.77 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|