C41H44O9S — CID 46211607
[(2R,3R,4S,5R,6S)-4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(4-octoxyphenyl)sulfanyloxan-3-yl] benzoate (PubChem CID 46211607) has the molecular formula C41H44O9S and a molecular weight of 712.86 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(4-octoxyphenyl)sulfanyloxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5R,6S)-4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(4-octoxyphenyl)sulfanyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 46211607 |
| Molecular Formula | C41H44O9S |
| Molecular Weight | 712.86 g/mol |
| Exact Mass | 712.27 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(4-octoxyphenyl)sulfanyloxan-3-yl] benzoate |
| SMILES | CCCCCCCCOc1ccc(S[C@@H]2O[C@H](CO)[C@@H](OC(=O)c3ccccc3)[C@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C41H44O9S/c1-2-3-4-5-6-16-27-46-32-23-25-33(26-24-32)51-41-37(50-40(45)31-21-14-9-15-22-31)36(49-39(44)30-19-12-8-13-20-30)35(34(28-42)47-41)48-38(43)29-17-10-7-11-18-29/h7-15,17-26,34-37,41-42H,2-6,16,27-28H2,1H3/t34-,35-,36+,37-,41+/m1/s1 |
| InChIKey | BOFHVDQITJJOGO-QEAQUCHQSA-N |
| XLogP | 7.91 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.86 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|