C21H17BrN4 — CID 4621392
N-[[2-(1H-benzimidazol-2-yl)-1-(4-bromophenyl)ethylidene]amino]aniline (PubChem CID 4621392) has the molecular formula C21H17BrN4 and a molecular weight of 405.30 g/mol. Its IUPAC name is N-[[2-(1H-benzimidazol-2-yl)-1-(4-bromophenyl)ethylidene]amino]aniline.
| Compound Name | N-[[2-(1H-benzimidazol-2-yl)-1-(4-bromophenyl)ethylidene]amino]aniline |
|---|---|
| PubChem CID | 4621392 |
| Molecular Formula | C21H17BrN4 |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | N-[[2-(1H-benzimidazol-2-yl)-1-(4-bromophenyl)ethylidene]amino]aniline |
| SMILES | Brc1ccc(C(Cc2nc3ccccc3[nH]2)=NNc2ccccc2)cc1 |
| InChI | InChI=1S/C21H17BrN4/c22-16-12-10-15(11-13-16)20(26-25-17-6-2-1-3-7-17)14-21-23-18-8-4-5-9-19(18)24-21/h1-13,25H,14H2,(H,23,24) |
| InChIKey | AGRSBCCMJJSQCG-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|