C18H16BrN5 — CID 6520359
3-[(2E)-2-[2-(1H-benzimidazol-2-yl)-1-(4-bromophenyl)ethylidene]hydrazinyl]propanenitrile (PubChem CID 6520359) has the molecular formula C18H16BrN5 and a molecular weight of 382.27 g/mol. Its IUPAC name is 3-[(2E)-2-[2-(1H-benzimidazol-2-yl)-1-(4-bromophenyl)ethylidene]hydrazinyl]propanenitrile.
| Compound Name | 3-[(2E)-2-[2-(1H-benzimidazol-2-yl)-1-(4-bromophenyl)ethylidene]hydrazinyl]propanenitrile |
|---|---|
| PubChem CID | 6520359 |
| Molecular Formula | C18H16BrN5 |
| Molecular Weight | 382.27 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 3-[(2E)-2-[2-(1H-benzimidazol-2-yl)-1-(4-bromophenyl)ethylidene]hydrazinyl]propanenitrile |
| SMILES | N#CCCN/N=C(\Cc1nc2ccccc2[nH]1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H16BrN5/c19-14-8-6-13(7-9-14)17(24-21-11-3-10-20)12-18-22-15-4-1-2-5-16(15)23-18/h1-2,4-9,21H,3,11-12H2,(H,22,23)/b24-17+ |
| InChIKey | WTFWFBHRFSIZLU-JJIBRWJFSA-N |
| XLogP | 3.78 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|