C20H20N4 — CID 4656710
N-[[2-(1H-benzimidazol-2-yl)-1-phenylethylidene]amino]cyclopentanimine (PubChem CID 4656710) has the molecular formula C20H20N4 and a molecular weight of 316.41 g/mol. Its IUPAC name is N-[[2-(1H-benzimidazol-2-yl)-1-phenylethylidene]amino]cyclopentanimine.
| Compound Name | N-[[2-(1H-benzimidazol-2-yl)-1-phenylethylidene]amino]cyclopentanimine |
|---|---|
| PubChem CID | 4656710 |
| Molecular Formula | C20H20N4 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | N-[[2-(1H-benzimidazol-2-yl)-1-phenylethylidene]amino]cyclopentanimine |
| SMILES | c1ccc(C(Cc2nc3ccccc3[nH]2)=NN=C2CCCC2)cc1 |
| InChI | InChI=1S/C20H20N4/c1-2-8-15(9-3-1)19(24-23-16-10-4-5-11-16)14-20-21-17-12-6-7-13-18(17)22-20/h1-3,6-9,12-13H,4-5,10-11,14H2,(H,21,22) |
| InChIKey | XPMJBSULRACHEA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|