C18H24N4O — CID 46214946
4,5,6,7-tetradeuterio-N-[(1R,5R)-1,2,2,4,4,5,6,6,7,7,8,8-dodecadeuterio-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]-1-methylindazole-3-carboxamide (PubChem CID 46214946) has the molecular formula C18H24N4O and a molecular weight of 328.51 g/mol. Its IUPAC name is 4,5,6,7-tetradeuterio-N-[(1R,5R)-1,2,2,4,4,5,6,6,7,7,8,8-dodecadeuterio-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]-1-methylindazole-3-carboxamide.
| Compound Name | 4,5,6,7-tetradeuterio-N-[(1R,5R)-1,2,2,4,4,5,6,6,7,7,8,8-dodecadeuterio-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]-1-methylindazole-3-carboxamide |
|---|---|
| PubChem CID | 46214946 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 328.51 g/mol |
| Exact Mass | 328.30 |
| IUPAC Name | 4,5,6,7-tetradeuterio-N-[(1R,5R)-1,2,2,4,4,5,6,6,7,7,8,8-dodecadeuterio-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]-1-methylindazole-3-carboxamide |
| SMILES | [2H]c1c([2H])c([2H])c2c(c(C(=O)NC3C([2H])([2H])[C@]4([2H])N(C)[C@@]([2H])(C3([2H])[2H])C([2H])([2H])C([2H])([2H])C4([2H])[2H])nn2C)c1[2H] |
| InChI | InChI=1S/C18H24N4O/c1-21-13-6-5-7-14(21)11-12(10-13)19-18(23)17-15-8-3-4-9-16(15)22(2)20-17/h3-4,8-9,12-14H,5-7,10-11H2,1-2H3,(H,19,23)/t13-,14-/m1/s1/i3D,4D,5D2,6D2,7D2,8D,9D,10D2,11D2,13D,14D |
| InChIKey | MFWNKCLOYSRHCJ-DYNHDWDESA-N |
| XLogP | 2.32 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |