C24H45NO3S2 — CID 46215046
(E)-N-[2-(2-ethenylsulfonylethylsulfanyl)ethyl]octadec-9-enamide (PubChem CID 46215046) has the molecular formula C24H45NO3S2 and a molecular weight of 459.76 g/mol. Its IUPAC name is (E)-N-[2-(2-ethenylsulfonylethylsulfanyl)ethyl]octadec-9-enamide.
| Compound Name | (E)-N-[2-(2-ethenylsulfonylethylsulfanyl)ethyl]octadec-9-enamide |
|---|---|
| PubChem CID | 46215046 |
| Molecular Formula | C24H45NO3S2 |
| Molecular Weight | 459.76 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | (E)-N-[2-(2-ethenylsulfonylethylsulfanyl)ethyl]octadec-9-enamide |
| SMILES | C=CS(=O)(=O)CCSCCNC(=O)CCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C24H45NO3S2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(26)25-20-21-29-22-23-30(27,28)4-2/h4,11-12H,2-3,5-10,13-23H2,1H3,(H,25,26)/b12-11+ |
| InChIKey | HTVLVLOCKSRERE-VAWYXSNFSA-N |
| XLogP | 6.43 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.76 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|