C18H19N3O — CID 46215334
5,6,7,8-tetradeuterio-3-[(4,5-dideuterio-2-methylimidazol-1-yl)methyl]-9-methyl-2,3-dihydro-1H-carbazol-4-one (PubChem CID 46215334) has the molecular formula C18H19N3O and a molecular weight of 299.41 g/mol. Its IUPAC name is 5,6,7,8-tetradeuterio-3-[(4,5-dideuterio-2-methylimidazol-1-yl)methyl]-9-methyl-2,3-dihydro-1H-carbazol-4-one.
| Compound Name | 5,6,7,8-tetradeuterio-3-[(4,5-dideuterio-2-methylimidazol-1-yl)methyl]-9-methyl-2,3-dihydro-1H-carbazol-4-one |
|---|---|
| PubChem CID | 46215334 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 5,6,7,8-tetradeuterio-3-[(4,5-dideuterio-2-methylimidazol-1-yl)methyl]-9-methyl-2,3-dihydro-1H-carbazol-4-one |
| SMILES | [2H]c1nc(C)n(CC2CCc3c(c4c([2H])c([2H])c([2H])c([2H])c4n3C)C2=O)c1[2H] |
| InChI | InChI=1S/C18H19N3O/c1-12-19-9-10-21(12)11-13-7-8-16-17(18(13)22)14-5-3-4-6-15(14)20(16)2/h3-6,9-10,13H,7-8,11H2,1-2H3/i3D,4D,5D,6D,9D,10D |
| InChIKey | FELGMEQIXOGIFQ-LJYPPAMPSA-N |
| XLogP | 3.13 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |