C21H23BrN4O — CID 46215470
[1-[4-[2-(4-bromophenyl)ethylamino]quinazolin-2-yl]pyrrolidin-2-yl]methanol (PubChem CID 46215470) has the molecular formula C21H23BrN4O and a molecular weight of 427.35 g/mol. Its IUPAC name is [1-[4-[2-(4-bromophenyl)ethylamino]quinazolin-2-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [1-[4-[2-(4-bromophenyl)ethylamino]quinazolin-2-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 46215470 |
| Molecular Formula | C21H23BrN4O |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | [1-[4-[2-(4-bromophenyl)ethylamino]quinazolin-2-yl]pyrrolidin-2-yl]methanol |
| SMILES | OCC1CCCN1c1nc(NCCc2ccc(Br)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C21H23BrN4O/c22-16-9-7-15(8-10-16)11-12-23-20-18-5-1-2-6-19(18)24-21(25-20)26-13-3-4-17(26)14-27/h1-2,5-10,17,27H,3-4,11-14H2,(H,23,24,25) |
| InChIKey | QMNVBGIYXVBPAO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |