C19H13Cl2FN4 — CID 46215647
3-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 46215647) has the molecular formula C19H13Cl2FN4 and a molecular weight of 387.25 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 46215647 |
| Molecular Formula | C19H13Cl2FN4 |
| Molecular Weight | 387.25 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CC(c1c(Cl)ccc(F)c1Cl)c1c[nH]c2ncc(-c3cncnc3)cc12 |
| InChI | InChI=1S/C19H13Cl2FN4/c1-10(17-15(20)2-3-16(22)18(17)21)14-8-26-19-13(14)4-11(7-25-19)12-5-23-9-24-6-12/h2-10H,1H3,(H,25,26) |
| InChIKey | UGRANSOABWHRIL-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.25 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|