About 3-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridine
3-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 46215647) has the molecular formula C19H13Cl2FN4
and a molecular weight of 387.25 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 46215647 |
| Molecular Formula | C19H13Cl2FN4 |
| Molecular Weight | 387.25 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CC(c1c(Cl)ccc(F)c1Cl)c1c[nH]c2ncc(-c3cncnc3)cc12 |
| InChI | InChI=1S/C19H13Cl2FN4/c1-10(17-15(20)2-3-16(22)18(17)21)14-8-26-19-13(14)4-11(7-25-19)12-5-23-9-24-6-12/h2-10H,1H3,(H,25,26) |
| InChIKey | UGRANSOABWHRIL-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.25 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 3-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridine (CID 46215647) is 3-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 3-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 3-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridine is CC(c1c(Cl)ccc(F)c1Cl)c1c[nH]c2ncc(-c3cncnc3)cc12.
What is the InChIKey of 3-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is UGRANSOABWHRIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13Cl2FN4/c1-10(17-15(20)2-3-16(22)18(17)21)14-8-26-19-13(14)4-11(7-25-19)12-5-23-9-24-6-12/h2-10H,1H3,(H,25,26).
What are the key properties of 3-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridine?
3-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 387.25 g/mol, XLogP of 5.62, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 46215647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).