C20H19Cl2FN4O — CID 163952220
2-[[3-amino-2-[3-[(1S)-1-(2,6-dichloro-3-fluorophenyl)ethyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]prop-2-enylidene]amino]ethanol (PubChem CID 163952220) has the molecular formula C20H19Cl2FN4O and a molecular weight of 421.30 g/mol. Its IUPAC name is 2-[[3-amino-2-[3-[(1S)-1-(2,6-dichloro-3-fluorophenyl)ethyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]prop-2-enylidene]amino]ethanol.
| Compound Name | 2-[[3-amino-2-[3-[(1S)-1-(2,6-dichloro-3-fluorophenyl)ethyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]prop-2-enylidene]amino]ethanol |
|---|---|
| PubChem CID | 163952220 |
| Molecular Formula | C20H19Cl2FN4O |
| Molecular Weight | 421.30 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 2-[[3-amino-2-[3-[(1S)-1-(2,6-dichloro-3-fluorophenyl)ethyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]prop-2-enylidene]amino]ethanol |
| SMILES | C[C@H](c1c(Cl)ccc(F)c1Cl)c1c[nH]c2ncc(C(=CN)/C=N/CCO)cc12 |
| InChI | InChI=1S/C20H19Cl2FN4O/c1-11(18-16(21)2-3-17(23)19(18)22)15-10-27-20-14(15)6-12(9-26-20)13(7-24)8-25-4-5-28/h2-3,6-11,28H,4-5,24H2,1H3,(H,26,27)/b13-7?,25-8+/t11-/m0/s1 |
| InChIKey | LTGLKOURQNRDEP-MHFPDNFKSA-N |
| XLogP | 4.52 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.30 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|