C21H24Cl2FN5O — CID 134268800
5-[(Z)-1-amino-3-piperidin-4-yliminoprop-1-en-2-yl]-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine (PubChem CID 134268800) has the molecular formula C21H24Cl2FN5O and a molecular weight of 452.36 g/mol. Its IUPAC name is 5-[(Z)-1-amino-3-piperidin-4-yliminoprop-1-en-2-yl]-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine.
| Compound Name | 5-[(Z)-1-amino-3-piperidin-4-yliminoprop-1-en-2-yl]-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine |
|---|---|
| PubChem CID | 134268800 |
| Molecular Formula | C21H24Cl2FN5O |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 5-[(Z)-1-amino-3-piperidin-4-yliminoprop-1-en-2-yl]-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine |
| SMILES | CC(Oc1cc(C(=C/N)/C=N/C2CCNCC2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C21H24Cl2FN5O/c1-12(19-16(22)2-3-17(24)20(19)23)30-18-8-13(10-29-21(18)26)14(9-25)11-28-15-4-6-27-7-5-15/h2-3,8-12,15,27H,4-7,25H2,1H3,(H2,26,29)/b14-9+,28-11+ |
| InChIKey | FBSDXBVJEXDXQS-XQMWYOTHSA-N |
| XLogP | 4.37 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|