C23H27Cl2FN4O — CID 123805943
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[(E)-4-methylimino-3-piperidin-4-ylbut-1-enyl]pyridin-2-amine (PubChem CID 123805943) has the molecular formula C23H27Cl2FN4O and a molecular weight of 465.40 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[(E)-4-methylimino-3-piperidin-4-ylbut-1-enyl]pyridin-2-amine.
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[(E)-4-methylimino-3-piperidin-4-ylbut-1-enyl]pyridin-2-amine |
|---|---|
| PubChem CID | 123805943 |
| Molecular Formula | C23H27Cl2FN4O |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[(E)-4-methylimino-3-piperidin-4-ylbut-1-enyl]pyridin-2-amine |
| SMILES | C/N=C/C(/C=C/c1cnc(N)c(OC(C)c2c(Cl)ccc(F)c2Cl)c1)C1CCNCC1 |
| InChI | InChI=1S/C23H27Cl2FN4O/c1-14(21-18(24)5-6-19(26)22(21)25)31-20-11-15(12-30-23(20)27)3-4-17(13-28-2)16-7-9-29-10-8-16/h3-6,11-14,16-17,29H,7-10H2,1-2H3,(H2,27,30)/b4-3+,28-13+ |
| InChIKey | BCYJYQCOSGARIR-MJBMYMHESA-N |
| XLogP | 5.58 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|