C27H28N4O4 — CID 46215965
8-[[3-[(4-nitrophenoxy)methyl]phenyl]methyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 46215965) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is 8-[[3-[(4-nitrophenoxy)methyl]phenyl]methyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-[[3-[(4-nitrophenoxy)methyl]phenyl]methyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 46215965 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 8-[[3-[(4-nitrophenoxy)methyl]phenyl]methyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | O=C1NCN(c2ccccc2)C12CCN(Cc1cccc(COc3ccc([N+](=O)[O-])cc3)c1)CC2 |
| InChI | InChI=1S/C27H28N4O4/c32-26-27(30(20-28-26)23-7-2-1-3-8-23)13-15-29(16-14-27)18-21-5-4-6-22(17-21)19-35-25-11-9-24(10-12-25)31(33)34/h1-12,17H,13-16,18-20H2,(H,28,32) |
| InChIKey | AGSINEABCLNZQC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|