C15H21FO2 — CID 46218389
(5aS,9aS,9bS)-9b-fluoro-6,6,9a-trimethyl-4,5,5a,7,8,9-hexahydrobenzo[g][2]benzofuran-1-one (PubChem CID 46218389) has the molecular formula C15H21FO2 and a molecular weight of 252.33 g/mol. Its IUPAC name is (5aS,9aS,9bS)-9b-fluoro-6,6,9a-trimethyl-4,5,5a,7,8,9-hexahydrobenzo[g][2]benzofuran-1-one.
| Compound Name | (5aS,9aS,9bS)-9b-fluoro-6,6,9a-trimethyl-4,5,5a,7,8,9-hexahydrobenzo[g][2]benzofuran-1-one |
|---|---|
| PubChem CID | 46218389 |
| Molecular Formula | C15H21FO2 |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | (5aS,9aS,9bS)-9b-fluoro-6,6,9a-trimethyl-4,5,5a,7,8,9-hexahydrobenzo[g][2]benzofuran-1-one |
| SMILES | CC1(C)CCC[C@@]2(C)[C@H]1CCC1=COC(=O)[C@@]12F |
| InChI | InChI=1S/C15H21FO2/c1-13(2)7-4-8-14(3)11(13)6-5-10-9-18-12(17)15(10,14)16/h9,11H,4-8H2,1-3H3/t11-,14-,15-/m0/s1 |
| InChIKey | WHXUNBMXIWZSGC-CQDKDKBSSA-N |
| XLogP | 3.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |