C8H17LiN2 — CID 46220878
lithium 2,2,6,6-tetramethylpiperazin-1-ide (PubChem CID 46220878) has the molecular formula C8H17LiN2 and a molecular weight of 148.18 g/mol. Its IUPAC name is lithium 2,2,6,6-tetramethylpiperazin-1-ide.
| Compound Name | lithium 2,2,6,6-tetramethylpiperazin-1-ide |
|---|---|
| PubChem CID | 46220878 |
| Molecular Formula | C8H17LiN2 |
| Molecular Weight | 148.18 g/mol |
| Exact Mass | 148.16 |
| IUPAC Name | lithium 2,2,6,6-tetramethylpiperazin-1-ide |
| SMILES | CC1(C)CNCC(C)(C)[N-]1.[Li+] |
| InChI | InChI=1S/C8H17N2.Li/c1-7(2)5-9-6-8(3,4)10-7;/h9H,5-6H2,1-4H3;/q-1;+1 |
| InChIKey | HMBIOKWUOXETJS-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 26.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.18 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |