C9H18NU- — CID 163645358
2,2,6,6-tetramethylpiperidin-1-ide;uranium (PubChem CID 163645358) has the molecular formula C9H18NU- and a molecular weight of 378.28 g/mol. Its IUPAC name is 2,2,6,6-tetramethylpiperidin-1-ide;uranium.
| Compound Name | 2,2,6,6-tetramethylpiperidin-1-ide;uranium |
|---|---|
| PubChem CID | 163645358 |
| Molecular Formula | C9H18NU- |
| Molecular Weight | 378.28 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 2,2,6,6-tetramethylpiperidin-1-ide;uranium |
| SMILES | CC1(C)CCCC(C)(C)[N-]1.[U] |
| InChI | InChI=1S/C9H18N.U/c1-8(2)6-5-7-9(3,4)10-8;/h5-7H2,1-4H3;/q-1; |
| InChIKey | HLOFNTGNJRFPPD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |