C18H36CoN2 — CID 140719434
cobalt(2+);bis(2,2,6,6-tetramethylpiperidin-1-ide) (PubChem CID 140719434) has the molecular formula C18H36CoN2 and a molecular weight of 339.43 g/mol. Its IUPAC name is cobalt(2+);bis(2,2,6,6-tetramethylpiperidin-1-ide).
| Compound Name | cobalt(2+);bis(2,2,6,6-tetramethylpiperidin-1-ide) |
|---|---|
| PubChem CID | 140719434 |
| Molecular Formula | C18H36CoN2 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | cobalt(2+);bis(2,2,6,6-tetramethylpiperidin-1-ide) |
| SMILES | CC1(C)CCCC(C)(C)[N-]1.CC1(C)CCCC(C)(C)[N-]1.[Co+2] |
| InChI | InChI=1S/2C9H18N.Co/c2*1-8(2)6-5-7-9(3,4)10-8;/h2*5-7H2,1-4H3;/q2*-1;+2 |
| InChIKey | NZPDAFHQFFOVNL-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |