C24H44N4NiO7 — CID 10674385
1,15,18,18,24,24-hexamethyl-2,5,8,11,14-pentaoxa-20,26-diaza-17,23-diazanidabicyclo[13.6.6]heptacosane-16,22-dione;nickel(2+) (PubChem CID 10674385) has the molecular formula C24H44N4NiO7 and a molecular weight of 559.33 g/mol. Its IUPAC name is 1,15,18,18,24,24-hexamethyl-2,5,8,11,14-pentaoxa-20,26-diaza-17,23-diazanidabicyclo[13.6.6]heptacosane-16,22-dione;nickel(2+).
| Compound Name | 1,15,18,18,24,24-hexamethyl-2,5,8,11,14-pentaoxa-20,26-diaza-17,23-diazanidabicyclo[13.6.6]heptacosane-16,22-dione;nickel(2+) |
|---|---|
| PubChem CID | 10674385 |
| Molecular Formula | C24H44N4NiO7 |
| Molecular Weight | 559.33 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | 1,15,18,18,24,24-hexamethyl-2,5,8,11,14-pentaoxa-20,26-diaza-17,23-diazanidabicyclo[13.6.6]heptacosane-16,22-dione;nickel(2+) |
| SMILES | CC1(C)CNCC2(C)OCCOCCOCCOCCOC(C)(CNCC(C)(C)[N-]C2=O)C(=O)[N-]1.[Ni+2] |
| InChI | InChI=1S/C24H46N4O7.Ni/c1-21(2)15-25-17-24(6)20(30)28-22(3,4)16-26-18-23(5,19(29)27-21)34-13-11-32-9-7-31-8-10-33-12-14-35-24;/h25-26H,7-18H2,1-6H3,(H2,27,28,29,30);/q;+2/p-2 |
| InChIKey | XSYDBSRYYBOCJE-UHFFFAOYSA-L |
| XLogP | 1.15 |
| TPSA | 132.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|