C13H11F3O2 — CID 46221563
3,4,5-trifluoro-6-propoxynaphthalen-2-ol (PubChem CID 46221563) has the molecular formula C13H11F3O2 and a molecular weight of 256.22 g/mol. Its IUPAC name is 3,4,5-trifluoro-6-propoxynaphthalen-2-ol.
| Compound Name | 3,4,5-trifluoro-6-propoxynaphthalen-2-ol |
|---|---|
| PubChem CID | 46221563 |
| Molecular Formula | C13H11F3O2 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 3,4,5-trifluoro-6-propoxynaphthalen-2-ol |
| SMILES | CCCOc1ccc2cc(O)c(F)c(F)c2c1F |
| InChI | InChI=1S/C13H11F3O2/c1-2-5-18-9-4-3-7-6-8(17)11(14)13(16)10(7)12(9)15/h3-4,6,17H,2,5H2,1H3 |
| InChIKey | FSSLSEUSDZRBQS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |