C20H18F4O2 — CID 90128808
3,4,5,6-tetrafluoro-2-(2-methoxyethyl)-7-propoxyphenanthrene (PubChem CID 90128808) has the molecular formula C20H18F4O2 and a molecular weight of 366.35 g/mol. Its IUPAC name is 3,4,5,6-tetrafluoro-2-(2-methoxyethyl)-7-propoxyphenanthrene.
| Compound Name | 3,4,5,6-tetrafluoro-2-(2-methoxyethyl)-7-propoxyphenanthrene |
|---|---|
| PubChem CID | 90128808 |
| Molecular Formula | C20H18F4O2 |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 3,4,5,6-tetrafluoro-2-(2-methoxyethyl)-7-propoxyphenanthrene |
| SMILES | CCCOc1cc2ccc3cc(CCOC)c(F)c(F)c3c2c(F)c1F |
| InChI | InChI=1S/C20H18F4O2/c1-3-7-26-14-10-12-5-4-11-9-13(6-8-25-2)17(21)19(23)15(11)16(12)20(24)18(14)22/h4-5,9-10H,3,6-8H2,1-2H3 |
| InChIKey | SIQAPTXUFQHYRQ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|