C15H18O2 — CID 46221668
[(1S,2S)-2-[(1R)-1-hydroxyprop-2-enyl]cyclopentyl]-phenylmethanone (PubChem CID 46221668) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is [(1S,2S)-2-[(1R)-1-hydroxyprop-2-enyl]cyclopentyl]-phenylmethanone.
| Compound Name | [(1S,2S)-2-[(1R)-1-hydroxyprop-2-enyl]cyclopentyl]-phenylmethanone |
|---|---|
| PubChem CID | 46221668 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | [(1S,2S)-2-[(1R)-1-hydroxyprop-2-enyl]cyclopentyl]-phenylmethanone |
| SMILES | C=C[C@@H](O)[C@H]1CCC[C@@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H18O2/c1-2-14(16)12-9-6-10-13(12)15(17)11-7-4-3-5-8-11/h2-5,7-8,12-14,16H,1,6,9-10H2/t12-,13-,14+/m0/s1 |
| InChIKey | HGVKRIRTHPGYPO-MELADBBJSA-N |
| XLogP | 2.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|