C16H13Cl4N4S+ — CID 4622264
[(2,4-dichlorophenyl)methylideneamino]-[N-[(2,4-dichlorophenyl)methylideneamino]-C-methylsulfanylcarbonimidoyl]azanium (PubChem CID 4622264) has the molecular formula C16H13Cl4N4S+ and a molecular weight of 435.19 g/mol. Its IUPAC name is [(2,4-dichlorophenyl)methylideneamino]-[N-[(2,4-dichlorophenyl)methylideneamino]-C-methylsulfanylcarbonimidoyl]azanium.
| Compound Name | [(2,4-dichlorophenyl)methylideneamino]-[N-[(2,4-dichlorophenyl)methylideneamino]-C-methylsulfanylcarbonimidoyl]azanium |
|---|---|
| PubChem CID | 4622264 |
| Molecular Formula | C16H13Cl4N4S+ |
| Molecular Weight | 435.19 g/mol |
| Exact Mass | 432.96 |
| IUPAC Name | [(2,4-dichlorophenyl)methylideneamino]-[N-[(2,4-dichlorophenyl)methylideneamino]-C-methylsulfanylcarbonimidoyl]azanium |
| SMILES | CSC(=NN=Cc1ccc(Cl)cc1Cl)[NH2+]N=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H12Cl4N4S/c1-25-16(23-21-8-10-2-4-12(17)6-14(10)19)24-22-9-11-3-5-13(18)7-15(11)20/h2-9H,1H3,(H,23,24)/p+1 |
| InChIKey | RESWFBPFCVRLLK-UHFFFAOYSA-O |
| XLogP | 4.95 |
| TPSA | 53.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.19 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|