C16H25NO4S — CID 46223481
2-(3,4-dimethoxyphenyl)ethanamine;2-[1-(sulfanylmethyl)cyclopropyl]acetic acid (PubChem CID 46223481) has the molecular formula C16H25NO4S and a molecular weight of 327.45 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)ethanamine;2-[1-(sulfanylmethyl)cyclopropyl]acetic acid.
| Compound Name | 2-(3,4-dimethoxyphenyl)ethanamine;2-[1-(sulfanylmethyl)cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 46223481 |
| Molecular Formula | C16H25NO4S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)ethanamine;2-[1-(sulfanylmethyl)cyclopropyl]acetic acid |
| SMILES | COc1ccc(CCN)cc1OC.O=C(O)CC1(CS)CC1 |
| InChI | InChI=1S/C10H15NO2.C6H10O2S/c1-12-9-4-3-8(5-6-11)7-10(9)13-2;7-5(8)3-6(4-9)1-2-6/h3-4,7H,5-6,11H2,1-2H3;9H,1-4H2,(H,7,8) |
| InChIKey | QPXOFWGDXFHKLO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|