C27H21ClO7 — CID 4622443
[3-(4-chlorophenyl)-4-oxochromen-7-yl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 4622443) has the molecular formula C27H21ClO7 and a molecular weight of 492.91 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-4-oxochromen-7-yl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [3-(4-chlorophenyl)-4-oxochromen-7-yl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4622443 |
| Molecular Formula | C27H21ClO7 |
| Molecular Weight | 492.91 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | [3-(4-chlorophenyl)-4-oxochromen-7-yl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)Oc2ccc3c(=O)c(-c4ccc(Cl)cc4)coc3c2)cc(OC)c1OC |
| InChI | InChI=1S/C27H21ClO7/c1-31-23-12-16(13-24(32-2)27(23)33-3)4-11-25(29)35-19-9-10-20-22(14-19)34-15-21(26(20)30)17-5-7-18(28)8-6-17/h4-15H,1-3H3 |
| InChIKey | VXLBTVGUXHLAMO-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.91 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|