C27H32N4O4 — CID 46228043
2-(5-aminopentanoylamino)-5-(3-aminopropoxy)-N-(4-phenoxyphenyl)benzamide (PubChem CID 46228043) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is 2-(5-aminopentanoylamino)-5-(3-aminopropoxy)-N-(4-phenoxyphenyl)benzamide.
| Compound Name | 2-(5-aminopentanoylamino)-5-(3-aminopropoxy)-N-(4-phenoxyphenyl)benzamide |
|---|---|
| PubChem CID | 46228043 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 2-(5-aminopentanoylamino)-5-(3-aminopropoxy)-N-(4-phenoxyphenyl)benzamide |
| SMILES | NCCCCC(=O)Nc1ccc(OCCCN)cc1C(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C27H32N4O4/c28-16-5-4-9-26(32)31-25-15-14-23(34-18-6-17-29)19-24(25)27(33)30-20-10-12-22(13-11-20)35-21-7-2-1-3-8-21/h1-3,7-8,10-15,19H,4-6,9,16-18,28-29H2,(H,30,33)(H,31,32) |
| InChIKey | KSUYVZQDQDRLAK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|