C22H27ClN2O — CID 46230582
4-[4-[(E)-2-(3-chlorophenyl)-1-phenylethenyl]piperazin-1-yl]butan-1-ol (PubChem CID 46230582) has the molecular formula C22H27ClN2O and a molecular weight of 370.92 g/mol. Its IUPAC name is 4-[4-[(E)-2-(3-chlorophenyl)-1-phenylethenyl]piperazin-1-yl]butan-1-ol.
| Compound Name | 4-[4-[(E)-2-(3-chlorophenyl)-1-phenylethenyl]piperazin-1-yl]butan-1-ol |
|---|---|
| PubChem CID | 46230582 |
| Molecular Formula | C22H27ClN2O |
| Molecular Weight | 370.92 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 4-[4-[(E)-2-(3-chlorophenyl)-1-phenylethenyl]piperazin-1-yl]butan-1-ol |
| SMILES | OCCCCN1CCN(/C(=C/c2cccc(Cl)c2)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H27ClN2O/c23-21-10-6-7-19(17-21)18-22(20-8-2-1-3-9-20)25-14-12-24(13-15-25)11-4-5-16-26/h1-3,6-10,17-18,26H,4-5,11-16H2/b22-18+ |
| InChIKey | NUTXMTRRKUIDED-RELWKKBWSA-N |
| XLogP | 4.23 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.92 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|