C16H20ClN3 — CID 46231557
N-[(4-chlorophenyl)methyl]-2-[(1S,2R)-2-(5-methyl-1H-imidazol-4-yl)cyclopropyl]ethanamine (PubChem CID 46231557) has the molecular formula C16H20ClN3 and a molecular weight of 289.81 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[(1S,2R)-2-(5-methyl-1H-imidazol-4-yl)cyclopropyl]ethanamine.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[(1S,2R)-2-(5-methyl-1H-imidazol-4-yl)cyclopropyl]ethanamine |
|---|---|
| PubChem CID | 46231557 |
| Molecular Formula | C16H20ClN3 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[(1S,2R)-2-(5-methyl-1H-imidazol-4-yl)cyclopropyl]ethanamine |
| SMILES | Cc1[nH]cnc1[C@@H]1C[C@H]1CCNCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClN3/c1-11-16(20-10-19-11)15-8-13(15)6-7-18-9-12-2-4-14(17)5-3-12/h2-5,10,13,15,18H,6-9H2,1H3,(H,19,20)/t13-,15-/m1/s1 |
| InChIKey | NOSCCMUAADBXHH-UKRRQHHQSA-N |
| XLogP | 3.65 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|