C20H33BrO2 — CID 46232271
1-[(3S,3aS,5aS,6S,8S,9S,9aS,9bR)-6-bromo-8-hydroxy-3a,5a-dimethyl-3-propan-2-yl-2,3,4,5,6,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-9-yl]ethanone (PubChem CID 46232271) has the molecular formula C20H33BrO2 and a molecular weight of 385.39 g/mol. Its IUPAC name is 1-[(3S,3aS,5aS,6S,8S,9S,9aS,9bR)-6-bromo-8-hydroxy-3a,5a-dimethyl-3-propan-2-yl-2,3,4,5,6,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-9-yl]ethanone.
| Compound Name | 1-[(3S,3aS,5aS,6S,8S,9S,9aS,9bR)-6-bromo-8-hydroxy-3a,5a-dimethyl-3-propan-2-yl-2,3,4,5,6,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-9-yl]ethanone |
|---|---|
| PubChem CID | 46232271 |
| Molecular Formula | C20H33BrO2 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 1-[(3S,3aS,5aS,6S,8S,9S,9aS,9bR)-6-bromo-8-hydroxy-3a,5a-dimethyl-3-propan-2-yl-2,3,4,5,6,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-9-yl]ethanone |
| SMILES | CC(=O)[C@H]1[C@@H]2[C@H]3CC[C@@H](C(C)C)[C@]3(C)CC[C@]2(C)[C@@H](Br)C[C@@H]1O |
| InChI | InChI=1S/C20H33BrO2/c1-11(2)13-6-7-14-18-17(12(3)22)15(23)10-16(21)20(18,5)9-8-19(13,14)4/h11,13-18,23H,6-10H2,1-5H3/t13-,14+,15-,16-,17+,18-,19-,20+/m0/s1 |
| InChIKey | QWBOKBWTXUULSX-SMFWUXHRSA-N |
| XLogP | 4.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|